Operators in Java MCQ10 Sept 2024 | 6 min read Java is a popular programming language that is widely used for developing applications in various domains such as web development, mobile app development, and more. In Java, operators are used to perform various operations on variables and values. In this section, we will discuss frequently asked multiple-choice questions (MCQs) on operators in Java, along with their answers and explanations. 1) Which of the following is a relational operator in Java?
Answer: c Explanation: The relational operator in Java is used to compare two values. The == operator is used to check if two values are equal or not. 2) Which of the following operators is used to perform addition in Java?
Answer: a Explanation: The + operator is used to perform addition in Java. 3) Which of the following operators is used to perform division in Java?
Answer: d Explanation: The / operator is used to perform division in Java. 4) Which of the following is a logical operator in Java?
Answer: c Explanation: The logical operator in Java is used to perform logical operations such as AND, OR, and NOT. The && operator is used to perform the logical AND operation. 5) Which of the following is a unary operator in Java?
Answer: c Explanation: The unary operator in Java is used to operate on a single operand. The - operator is used to perform negation or change the sign of a value. 6) Which of the following operators has the highest precedence in Java?
Answer: c Explanation: The increment operator (++) has the highest precedence in Java. 7) Which of the following operators is used to perform modulo division in Java?
Answer: b Explanation: The % operator is used to perform modulo division in Java. 8) Which of the following operators is used to perform bitwise AND in Java?
Answer: a Explanation: The & operator is used to perform bitwise AND in Java. 9) Which of the following operators is used to perform equality comparison in Java?
Answer: b Explanation: The == operator is used to perform equality comparison in Java. 10) Which of the following operators is used to perform bitwise OR in Java?
Answer: a Explanation: The | operator is used to perform bitwise OR in Java. 11) What is the output of the following code snippet?
Answer: a Explanation: The output of the code snippet int i = 0; while (i < 3) { System.out.print(i + " "); i++; } is 0 1 2 because the while loop will iterate three times (until i is equal to 3), and on each iteration, it will print the current value of i and increment it by 1. 12) Which of the following is not a valid primitive data type in Java?
Answer: d Explanation: string is not a valid primitive data type in Java. The correct spelling for the string data type is String (capitalized). 13) What is the output of the following code snippet?
Answer: a Explanation: The output of the code snippet int x = 5; int y = 10; if (x < y) { System.out.println("x is less than y"); } else { System.out.println("x is greater than or equal to y"); } is x is less than y because x is less than y, so the if block is executed and prints the corresponding message. 14) Which of the following operators is used to perform decrement in Java?
Answer: a Explanation: The decrement operator (--) is used to decrease the value of a variable by 1 in Java. 15) Which of the following operators is used to perform logical OR in Java?
Answer: c Explanation: The | operator is used to perform logical OR in Java. 16) Whatt is the output of the following code snippet?
Answer: a Explanation: The output of the code snippet int a = 5; int b = 2; int c = a / b; System.out.println(c); is 2 because integer division is performed, which truncates the decimal part. 17) Which of the following operators is used to perform left shift in Java?
Answer: a Explanation: The << operator is used to perform left shift in Java. 18) Which of the following is not a valid identifier in Java?
Answer: c Explanation: Identifiers in Java cannot start with a digit. Therefore, 123test is not a valid identifier. 19) Which of the following is a conditional operator in Java?
Answer: d Explanation: The conditional operator (also known as ternary operator) in Java is represented by the ? symbol. It is used to evaluate a boolean expression and return one of two values based on the result. 20) What is the output of the following code snippet?
Answer: c Explanation: The output of the code snippet int x = 10; int y = 20; int z = x++ + ++y; System.out.println(z); is 33. The value of z is computed as 10 + 21 (x++ returns the original value of x, while ++y increments y before its value is used in the expression). 21) Which of the following is a unary logical operator in Java?
Answer: a Explanation: The ! operator is a unary logical operator in Java. It is used to perform the logical NOT operation. 22) What is the output of the following code snippet?
Answer: a Explanation: The output of the code snippet int i = 0; do { System.out.print(i + " "); i++; } while (i < 3); is 0 1 2 because the do-while loop will iterate three times (until i is equal to 3), and on each iteration, it will print the current value of i and increment it by 1. 23) Which of the following operators is used to perform bitwise XOR in Java?
Answer: a Explanation: The ^ operator is used to perform bitwise XOR (exclusive OR) in Java. It returns a 1 in each bit position where the corresponding bits of either but not both operands are 1. 24) What is the output of the following code snippet?
Answer: b Explanation: The output of the code snippet int a = 5; int b = 7; System.out.println((a > b) ? "a is greater than b" : "a is less than or equal to b"); is a is less than or equal to b because the expression (a > b) is false, so the second option in the ternary operator is executed. Next TopicSeparators In Java |
Prime factorization is a fundamental concept in number theory that involves breaking down a composite number into its smallest prime factors. This process is invaluable in various fields of mathematics and computer science, including cryptography and number theory. In this section, we will explore how to...
4 min read
The assert keyword in Java is used for debugging purposes. It is primarily used to test assumptions in the code by throwing an AssertionError if an expression evaluates to false. Assertions are typically used during development and testing but are disabled by default at runtime. To...
3 min read
In Java, Collection is a framework that provides interfaces (Set, List, Queue, etc.) and classes (ArrayList, LinkedList, etc.) to store the group of objects. These classes store data in an unordered manner. Sometimes we need to arrange data in an ordered manner which is known...
8 min read
Hash tables are a fundamental data structure in computer science, providing efficient storage and retrieval of key-value pairs. They achieve average-case constant time complexity for search, insert, and delete operations, making them highly valuable for various applications such as database indexing, caching, and associative arrays....
6 min read
Problem Statement Design and implement a program to generate the Newman-Conway sequence, a recursive integer sequence defined by the following recurrence relations: P(1)=1 P(2)=1 P(n)=P(P(n-1))+P(n-P(n-1))forn>2 Given an integer n, this system accurately calculates and generates the first n phrases...
6 min read
Problem statement You are given three integer arrays of size N, which represent the height, width and length of N boxes, respectively. Your task is to stack the boxes on each other such that the height should be maximum, and you have to return the height. To put one...
6 min read
Are you a Java Developer or a Student looking to enhance your programming skills? Java is one of the most widely used programming languages. So, it will be a great choice to learn Java. There are many resources available on the web from where you can learn...
9 min read
Java SE 7 introduced major improvements to how errors are handled, bringing in features that make error management in Java applications simpler and more efficient. These changes aimed to improve code readability, decrease repetitive code (boilerplate), and enhance the overall experience for developers. The evolution of exception...
7 min read
Java is the most popular object-oriented programming language. It provides a variety of salient features that are preferred by the developers. It is the reason that a billion of devices runs on Java. In this section, we are going to discuss why Java is secure. Java...
3 min read
API (Application Programming Interface) development is an essential aspect of modern software development. APIs allow different software systems to communicate with each other and share data and functionality, enabling developers to build complex applications by leveraging existing resources. Java, a popular and powerful programming language, provides...
5 min read
We request you to subscribe our newsletter for upcoming updates.
We provides tutorials and interview questions of all technology like java tutorial, android, java frameworks
G-13, 2nd Floor, Sec-3, Noida, UP, 201301, India